C13H20N2 — CID 124706685
(2S)-2-methyl-1-phenyl-1,4-diazocane (PubChem CID 124706685) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2S)-2-methyl-1-phenyl-1,4-diazocane.
| Compound Name | (2S)-2-methyl-1-phenyl-1,4-diazocane |
|---|---|
| PubChem CID | 124706685 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2S)-2-methyl-1-phenyl-1,4-diazocane |
| SMILES | C[C@H]1CNCCCCN1c1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-12-11-14-9-5-6-10-15(12)13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11H2,1H3/t12-/m0/s1 |
| InChIKey | SNSNEOQYPHSDBT-LBPRGKRZSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |