C18H20N2O2 — CID 95001107
(2-methoxyphenyl)-[(2R)-2-phenylpiperazin-1-yl]methanone (PubChem CID 95001107) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2-methoxyphenyl)-[(2R)-2-phenylpiperazin-1-yl]methanone.
| Compound Name | (2-methoxyphenyl)-[(2R)-2-phenylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 95001107 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2-methoxyphenyl)-[(2R)-2-phenylpiperazin-1-yl]methanone |
| SMILES | COc1ccccc1C(=O)N1CCNC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-22-17-10-6-5-9-15(17)18(21)20-12-11-19-13-16(20)14-7-3-2-4-8-14/h2-10,16,19H,11-13H2,1H3/t16-/m0/s1 |
| InChIKey | SUBCTMLXNZNNJN-INIZCTEOSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |