C14H19NO — CID 106778974
2-methyl-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106778974) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-methyl-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-methyl-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106778974 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-methyl-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CC(C2CCOC2)c2ccccc2N1 |
| InChI | InChI=1S/C14H19NO/c1-10-8-13(11-6-7-16-9-11)12-4-2-3-5-14(12)15-10/h2-5,10-11,13,15H,6-9H2,1H3 |
| InChIKey | JMWRPKGBNFIGAR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |