C14H19NO — CID 84683089
4-methoxy-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole (PubChem CID 84683089) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-methoxy-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole.
| Compound Name | 4-methoxy-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole |
|---|---|
| PubChem CID | 84683089 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-methoxy-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]indole |
| SMILES | COc1cccc2c1NC1CCCCCC21 |
| InChI | InChI=1S/C14H19NO/c1-16-13-9-5-7-11-10-6-3-2-4-8-12(10)15-14(11)13/h5,7,9-10,12,15H,2-4,6,8H2,1H3 |
| InChIKey | DPLVRSFCOBMBAI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |