C13H15F3N2O — CID 118871730
N-[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide (PubChem CID 118871730) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide.
| Compound Name | N-[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide |
|---|---|
| PubChem CID | 118871730 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide |
| SMILES | CC[C@@H]1C[C@H](NC=O)c2cc(C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C13H15F3N2O/c1-2-9-6-12(17-7-19)10-5-8(13(14,15)16)3-4-11(10)18-9/h3-5,7,9,12,18H,2,6H2,1H3,(H,17,19)/t9-,12+/m1/s1 |
| InChIKey | ATMIPLRWLMNMCB-SKDRFNHKSA-N |
| XLogP | 3.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|