C25H25F9N2O2 — CID 159623094
(2S,4S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;ethyl formate (PubChem CID 159623094) has the molecular formula C25H25F9N2O2 and a molecular weight of 556.47 g/mol. Its IUPAC name is (2S,4S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;ethyl formate.
| Compound Name | (2S,4S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;ethyl formate |
|---|---|
| PubChem CID | 159623094 |
| Molecular Formula | C25H25F9N2O2 |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (2S,4S)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;ethyl formate |
| SMILES | CCOC=O.FC(F)(F)c1cc(CN[C@H]2C[C@@H](C3CC3)Nc3ccc(C(F)(F)F)cc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F9N2.C3H6O2/c23-20(24,25)13-3-4-17-16(8-13)19(9-18(33-17)12-1-2-12)32-10-11-5-14(21(26,27)28)7-15(6-11)22(29,30)31;1-2-5-3-4/h3-8,12,18-19,32-33H,1-2,9-10H2;3H,2H2,1H3/t18-,19-;/m0./s1 |
| InChIKey | MODIOHPNGCFKMI-HLRBRJAUSA-N |
| XLogP | 7.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|