C23H19F9N2O — CID 159715241
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide (PubChem CID 159715241) has the molecular formula C23H19F9N2O and a molecular weight of 510.40 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide |
|---|---|
| PubChem CID | 159715241 |
| Molecular Formula | C23H19F9N2O |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]formamide |
| SMILES | O=CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1C[C@@H](C2CC2)Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C23H19F9N2O/c24-21(25,26)14-3-4-18-17(8-14)20(9-19(33-18)13-1-2-13)34(11-35)10-12-5-15(22(27,28)29)7-16(6-12)23(30,31)32/h3-8,11,13,19-20,33H,1-2,9-10H2/t19-,20-/m0/s1 |
| InChIKey | YOUSJCGWIHSILT-PMACEKPBSA-N |
| XLogP | 7.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|