C23H21F9N2O2 — CID 90707514
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-(methoxymethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide (PubChem CID 90707514) has the molecular formula C23H21F9N2O2 and a molecular weight of 528.42 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-(methoxymethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-(methoxymethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide |
|---|---|
| PubChem CID | 90707514 |
| Molecular Formula | C23H21F9N2O2 |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-(methoxymethyl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide |
| SMILES | COC[C@@H]1C[C@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(C)=O)c2cc(C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C23H21F9N2O2/c1-12(35)34(10-13-5-15(22(27,28)29)7-16(6-13)23(30,31)32)20-9-17(11-36-2)33-19-4-3-14(8-18(19)20)21(24,25)26/h3-8,17,20,33H,9-11H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | BQDUVAJSTWVVQY-PXNSSMCTSA-N |
| XLogP | 6.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |