C23H20F9N3O — CID 160713569
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]urea (PubChem CID 160713569) has the molecular formula C23H20F9N3O and a molecular weight of 525.42 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]urea.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]urea |
|---|---|
| PubChem CID | 160713569 |
| Molecular Formula | C23H20F9N3O |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]urea |
| SMILES | NC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1C[C@@H](C2CC2)Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C23H20F9N3O/c24-21(25,26)13-3-4-17-16(8-13)19(9-18(34-17)12-1-2-12)35(20(33)36)10-11-5-14(22(27,28)29)7-15(6-11)23(30,31)32/h3-8,12,18-19,34H,1-2,9-10H2,(H2,33,36)/t18-,19-/m0/s1 |
| InChIKey | JNBILLUHJVMAIF-OALUTQOASA-N |
| XLogP | 6.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |