C28H24F12N2O3 — CID 54188389
propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 54188389) has the molecular formula C28H24F12N2O3 and a molecular weight of 664.49 g/mol. Its IUPAC name is propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 54188389 |
| Molecular Formula | C28H24F12N2O3 |
| Molecular Weight | 664.49 g/mol |
| Exact Mass | 664.16 |
| IUPAC Name | propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(2,2,2-trifluoroacetyl)amino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)OC(=O)N1c2ccc(C(F)(F)F)cc2[C@@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)C(F)(F)F)C[C@H]1C1CC1 |
| InChI | InChI=1S/C28H24F12N2O3/c1-13(2)45-24(44)42-20-6-5-16(25(29,30)31)10-19(20)22(11-21(42)15-3-4-15)41(23(43)28(38,39)40)12-14-7-17(26(32,33)34)9-18(8-14)27(35,36)37/h5-10,13,15,21-22H,3-4,11-12H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | PGTHBWOMHHRKGU-VXKWHMMOSA-N |
| XLogP | 8.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.49 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |