C27H24F9N3O2 — CID 87782137
propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-cyanoamino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 87782137) has the molecular formula C27H24F9N3O2 and a molecular weight of 593.49 g/mol. Its IUPAC name is propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-cyanoamino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-cyanoamino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 87782137 |
| Molecular Formula | C27H24F9N3O2 |
| Molecular Weight | 593.49 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | propan-2-yl (2S,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-cyanoamino]-2-cyclopropyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)OC(=O)N1c2ccc(C(F)(F)F)cc2[C@@H](N(C#N)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C[C@H]1C1CC1 |
| InChI | InChI=1S/C27H24F9N3O2/c1-14(2)41-24(40)39-21-6-5-17(25(28,29)30)10-20(21)23(11-22(39)16-3-4-16)38(13-37)12-15-7-18(26(31,32)33)9-19(8-15)27(34,35)36/h5-10,14,16,22-23H,3-4,11-12H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | SWQVPWVFLCLKJM-GOTSBHOMSA-N |
| XLogP | 8.30 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.49 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|