C17H23F3N2O2 — CID 160804155
(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propyl formate (PubChem CID 160804155) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is (2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propyl formate.
| Compound Name | (2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propyl formate |
|---|---|
| PubChem CID | 160804155 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propyl formate |
| SMILES | CCCOC=O.N[C@H]1C[C@@H](C2CC2)Nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H15F3N2.C4H8O2/c14-13(15,16)8-3-4-11-9(5-8)10(17)6-12(18-11)7-1-2-7;1-2-3-6-4-5/h3-5,7,10,12,18H,1-2,6,17H2;4H,2-3H2,1H3/t10-,12-;/m0./s1 |
| InChIKey | SDLWKCKNJUYGTL-JGAZGGJJSA-N |
| XLogP | 3.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|