C16H21F3N2O2 — CID 174445230
3-[4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate (PubChem CID 174445230) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 3-[4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate.
| Compound Name | 3-[4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate |
|---|---|
| PubChem CID | 174445230 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-[4-amino-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]propyl formate |
| SMILES | CCC1CC(N)c2cc(C(F)(F)F)ccc2N1CCCOC=O |
| InChI | InChI=1S/C16H21F3N2O2/c1-2-12-9-14(20)13-8-11(16(17,18)19)4-5-15(13)21(12)6-3-7-23-10-22/h4-5,8,10,12,14H,2-3,6-7,9,20H2,1H3 |
| InChIKey | CUZSEDOJZZFBTI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|