C21H25F3N4O3 — CID 177001695
4-[2-[[(2R)-2-ethyl-1-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrimidin-5-yl]oxybutanoic acid (PubChem CID 177001695) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is 4-[2-[[(2R)-2-ethyl-1-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrimidin-5-yl]oxybutanoic acid.
| Compound Name | 4-[2-[[(2R)-2-ethyl-1-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrimidin-5-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 177001695 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 4-[2-[[(2R)-2-ethyl-1-methyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrimidin-5-yl]oxybutanoic acid |
| SMILES | CC[C@@H]1CC(Nc2ncc(OCCCC(=O)O)cn2)c2cc(C(F)(F)F)ccc2N1C |
| InChI | InChI=1S/C21H25F3N4O3/c1-3-14-10-17(16-9-13(21(22,23)24)6-7-18(16)28(14)2)27-20-25-11-15(12-26-20)31-8-4-5-19(29)30/h6-7,9,11-12,14,17H,3-5,8,10H2,1-2H3,(H,29,30)(H,25,26,27)/t14-,17?/m1/s1 |
| InChIKey | HUHLYOVXFQTEEX-XPCCGILXSA-N |
| XLogP | 4.51 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|