C32H30F9N4O5+ — CID 176943940
(Z)-[3,5-bis(trifluoromethyl)phenyl]methyl-[5-(3-carboxypropoxy)pyrimidin-2-yl]-[(2R)-1-ethoxycarbonyl-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]azanium (PubChem CID 176943940) has the molecular formula C32H30F9N4O5+ and a molecular weight of 721.60 g/mol. Its IUPAC name is (Z)-[3,5-bis(trifluoromethyl)phenyl]methyl-[5-(3-carboxypropoxy)pyrimidin-2-yl]-[(2R)-1-ethoxycarbonyl-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]azanium.
| Compound Name | (Z)-[3,5-bis(trifluoromethyl)phenyl]methyl-[5-(3-carboxypropoxy)pyrimidin-2-yl]-[(2R)-1-ethoxycarbonyl-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]azanium |
|---|---|
| PubChem CID | 176943940 |
| Molecular Formula | C32H30F9N4O5+ |
| Molecular Weight | 721.60 g/mol |
| Exact Mass | 721.21 |
| IUPAC Name | (Z)-[3,5-bis(trifluoromethyl)phenyl]methyl-[5-(3-carboxypropoxy)pyrimidin-2-yl]-[(2R)-1-ethoxycarbonyl-2-ethyl-6-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]azanium |
| SMILES | CCOC(=O)N1c2ccc(C(F)(F)F)cc2/C(=[N+](/Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ncc(OCCCC(=O)O)cn2)C[C@H]1CC |
| InChI | InChI=1S/C32H29F9N4O5/c1-3-22-14-26(24-13-19(30(33,34)35)7-8-25(24)45(22)29(48)49-4-2)44(28-42-15-23(16-43-28)50-9-5-6-27(46)47)17-18-10-20(31(36,37)38)12-21(11-18)32(39,40)41/h7-8,10-13,15-16,22H,3-6,9,14,17H2,1-2H3/p+1/t22-/m1/s1 |
| InChIKey | MCHWTHROITVSGS-JOCHJYFZSA-O |
| XLogP | 8.26 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.60 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|