C15H19F3N2O2 — CID 87491854
2,2,2-trideuterioethyl (2R,4S)-4-amino-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 87491854) has the molecular formula C15H19F3N2O2 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2,2,2-trideuterioethyl (2R,4S)-4-amino-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | 2,2,2-trideuterioethyl (2R,4S)-4-amino-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 87491854 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2,2,2-trideuterioethyl (2R,4S)-4-amino-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | [2H]C([2H])([2H])COC(=O)N1c2ccc(C(F)(F)F)cc2[C@@H](N)C[C@H]1C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C15H19F3N2O2/c1-3-10-8-12(19)11-7-9(15(16,17)18)5-6-13(11)20(10)14(21)22-4-2/h5-7,10,12H,3-4,8,19H2,1-2H3/t10-,12+/m1/s1/i1D3,2D3,3D2 |
| InChIKey | AZFYCLSCZLWMBW-PBUYIITCSA-N |
| XLogP | 3.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |