C21H21F3N2O4 — CID 87494431
2-(1,1,2,2,2-pentadeuterioethyl)-4-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid (PubChem CID 87494431) has the molecular formula C21H21F3N2O4 and a molecular weight of 427.43 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentadeuterioethyl)-4-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid.
| Compound Name | 2-(1,1,2,2,2-pentadeuterioethyl)-4-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 87494431 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-(1,1,2,2,2-pentadeuterioethyl)-4-(phenylmethoxycarbonylamino)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1CC(NC(=O)OCc2ccccc2)c2cc(C(F)(F)F)ccc2N1C(=O)O |
| InChI | InChI=1S/C21H21F3N2O4/c1-2-15-11-17(25-19(27)30-12-13-6-4-3-5-7-13)16-10-14(21(22,23)24)8-9-18(16)26(15)20(28)29/h3-10,15,17H,2,11-12H2,1H3,(H,25,27)(H,28,29)/i1D3,2D2 |
| InChIKey | FLPTZWIBCVVWNY-ZBJDZAJPSA-N |
| XLogP | 5.34 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |