C24H21F9N2O4 — CID 87491878
4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid (PubChem CID 87491878) has the molecular formula C24H21F9N2O4 and a molecular weight of 577.45 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 87491878 |
| Molecular Formula | C24H21F9N2O4 |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1CC(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)OC)c2cc(C(F)(F)F)ccc2N1C(=O)O |
| InChI | InChI=1S/C24H21F9N2O4/c1-3-16-10-19(17-9-13(22(25,26)27)4-5-18(17)35(16)20(36)37)34(21(38)39-2)11-12-6-14(23(28,29)30)8-15(7-12)24(31,32)33/h4-9,16,19H,3,10-11H2,1-2H3,(H,36,37)/i1D3,3D2 |
| InChIKey | JRBOFAXVGHMLMM-WNWXXORZSA-N |
| XLogP | 7.72 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |