C16H23F3N2O2 — CID 174431550
2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propan-2-yl formate (PubChem CID 174431550) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propan-2-yl formate.
| Compound Name | 2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propan-2-yl formate |
|---|---|
| PubChem CID | 174431550 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-amine;propan-2-yl formate |
| SMILES | CC(C)OC=O.CCC1CC(N)c2cc(C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C12H15F3N2.C4H8O2/c1-2-8-6-10(16)9-5-7(12(13,14)15)3-4-11(9)17-8;1-4(2)6-3-5/h3-5,8,10,17H,2,6,16H2,1H3;3-4H,1-2H3 |
| InChIKey | GXBRAGIYFSKPPR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|