C13H17F3N2O3S — CID 87285060
[[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]amino] methanesulfonate (PubChem CID 87285060) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is [[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]amino] methanesulfonate.
| Compound Name | [[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]amino] methanesulfonate |
|---|---|
| PubChem CID | 87285060 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | [[(2R,4S)-2-ethyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]amino] methanesulfonate |
| SMILES | CC[C@@H]1C[C@H](NOS(C)(=O)=O)c2cc(C(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C13H17F3N2O3S/c1-3-9-7-12(18-21-22(2,19)20)10-6-8(13(14,15)16)4-5-11(10)17-9/h4-6,9,12,17-18H,3,7H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | LWGJWDZLJRLXKI-SKDRFNHKSA-N |
| XLogP | 2.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|