C22H25F3N2O5S2 — CID 59777754
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 59777754) has the molecular formula C22H25F3N2O5S2 and a molecular weight of 518.58 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 59777754 |
| Molecular Formula | C22H25F3N2O5S2 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C22H25F3N2O5S2/c1-33(28,29)13-34(30,31)26-12-16-8-9-17-20(14-5-3-2-4-6-14)27-19-10-7-15(22(23,24)25)11-18(19)21(17)32-16/h2-7,10-11,16-17,20-21,26-27H,8-9,12-13H2,1H3/t16-,17+,20+,21+/m1/s1 |
| InChIKey | GKURAHSFTZBZRA-SEONNTABSA-N |
| XLogP | 3.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |