C26H31F3N2O2 — CID 58956767
(2R,4aS,5R,10bS)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956767) has the molecular formula C26H31F3N2O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is (2R,4aS,5R,10bS)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2R,4aS,5R,10bS)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956767 |
| Molecular Formula | C26H31F3N2O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (2R,4aS,5R,10bS)-2-[(1-methylpiperidin-4-yl)oxymethyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CN1CCC(OC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31F3N2O2/c1-31-13-11-19(12-14-31)32-16-20-8-9-21-24(17-5-3-2-4-6-17)30-23-10-7-18(26(27,28)29)15-22(23)25(21)33-20/h2-7,10,15,19-21,24-25,30H,8-9,11-14,16H2,1H3/t20-,21+,24+,25+/m1/s1 |
| InChIKey | CRYIGTIKJAZSCD-QKYMMTCKSA-N |
| XLogP | 5.82 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |