C24H30F3N3O — CID 59777923
1-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-methylpropane-1,2-diamine (PubChem CID 59777923) has the molecular formula C24H30F3N3O and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-methylpropane-1,2-diamine.
| Compound Name | 1-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 59777923 |
| Molecular Formula | C24H30F3N3O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H30F3N3O/c1-23(2,28)14-29-13-17-9-10-18-21(15-6-4-3-5-7-15)30-20-11-8-16(24(25,26)27)12-19(20)22(18)31-17/h3-8,11-12,17-18,21-22,29-30H,9-10,13-14,28H2,1-2H3/t17-,18+,21+,22+/m1/s1 |
| InChIKey | SGVNNJXNROLDPV-KSCDAYEDSA-N |
| XLogP | 5.04 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |