C23H28F3N3O — CID 59778039
N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-methylethane-1,2-diamine (PubChem CID 59778039) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 59778039 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H28F3N3O/c1-29(12-11-27)14-17-8-9-18-21(15-5-3-2-4-6-15)28-20-10-7-16(23(24,25)26)13-19(20)22(18)30-17/h2-7,10,13,17-18,21-22,28H,8-9,11-12,14,27H2,1H3/t17-,18+,21+,22+/m1/s1 |
| InChIKey | GJAHXYVKZLWQNC-KSCDAYEDSA-N |
| XLogP | 4.60 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |