C29H32F3N3O — CID 59777881
N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-benzylethane-1,2-diamine (PubChem CID 59777881) has the molecular formula C29H32F3N3O and a molecular weight of 495.59 g/mol. Its IUPAC name is N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-benzylethane-1,2-diamine.
| Compound Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-benzylethane-1,2-diamine |
|---|---|
| PubChem CID | 59777881 |
| Molecular Formula | C29H32F3N3O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-benzylethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C29H32F3N3O/c30-29(31,32)22-11-14-26-25(17-22)28-24(27(34-26)21-9-5-2-6-10-21)13-12-23(36-28)19-35(16-15-33)18-20-7-3-1-4-8-20/h1-11,14,17,23-24,27-28,34H,12-13,15-16,18-19,33H2/t23-,24+,27+,28+/m1/s1 |
| InChIKey | LNPXIPBAOOLMFR-JGPKDBRGSA-N |
| XLogP | 6.17 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |