C28H29F3N2O — CID 59777999
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-phenylethanamine (PubChem CID 59777999) has the molecular formula C28H29F3N2O and a molecular weight of 466.55 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-phenylethanamine.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 59777999 |
| Molecular Formula | C28H29F3N2O |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-phenylethanamine |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1O[C@@H](CNCCc3ccccc3)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C28H29F3N2O/c29-28(30,31)21-11-14-25-24(17-21)27-23(26(33-25)20-9-5-2-6-10-20)13-12-22(34-27)18-32-16-15-19-7-3-1-4-8-19/h1-11,14,17,22-23,26-27,32-33H,12-13,15-16,18H2/t22-,23+,26+,27+/m1/s1 |
| InChIKey | KSXQHSVUAVRFGC-DTBHQADXSA-N |
| XLogP | 6.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|