C29H30F3N3O2 — CID 59777987
(2S)-2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]-3-phenylpropanamide (PubChem CID 59777987) has the molecular formula C29H30F3N3O2 and a molecular weight of 509.57 g/mol. Its IUPAC name is (2S)-2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 59777987 |
| Molecular Formula | C29H30F3N3O2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2S)-2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C29H30F3N3O2/c30-29(31,32)20-11-14-24-23(16-20)27-22(26(35-24)19-9-5-2-6-10-19)13-12-21(37-27)17-34-25(28(33)36)15-18-7-3-1-4-8-18/h1-11,14,16,21-22,25-27,34-35H,12-13,15,17H2,(H2,33,36)/t21-,22+,25+,26+,27+/m1/s1 |
| InChIKey | JZYUSZJAASTDEL-RDWBQTDYSA-N |
| XLogP | 5.39 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |