C25H31F3N4O2 — CID 67434244
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-amino-2-methylpropyl)urea (PubChem CID 67434244) has the molecular formula C25H31F3N4O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-amino-2-methylpropyl)urea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-amino-2-methylpropyl)urea |
|---|---|
| PubChem CID | 67434244 |
| Molecular Formula | C25H31F3N4O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-amino-2-methylpropyl)urea |
| SMILES | CC(C)(N)CNC(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H31F3N4O2/c1-24(2,29)14-31-23(33)30-13-17-9-10-18-21(15-6-4-3-5-7-15)32-20-11-8-16(25(26,27)28)12-19(20)22(18)34-17/h3-8,11-12,17-18,21-22,32H,9-10,13-14,29H2,1-2H3,(H2,30,31,33)/t17-,18+,21+,22+/m1/s1 |
| InChIKey | KHBUICMKUSILSY-KSCDAYEDSA-N |
| XLogP | 4.74 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |