C32H42F3N5O4 — CID 59778085
tert-butyl 4-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]piperazine-1-carboxylate (PubChem CID 59778085) has the molecular formula C32H42F3N5O4 and a molecular weight of 617.71 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59778085 |
| Molecular Formula | C32H42F3N5O4 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | tert-butyl 4-[2-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylcarbamoylamino]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCNC(=O)NC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C32H42F3N5O4/c1-31(2,3)44-30(42)40-17-15-39(16-18-40)14-13-36-29(41)37-20-23-10-11-24-27(21-7-5-4-6-8-21)38-26-12-9-22(32(33,34)35)19-25(26)28(24)43-23/h4-9,12,19,23-24,27-28,38H,10-11,13-18,20H2,1-3H3,(H2,36,37,41)/t23-,24+,27+,28+/m1/s1 |
| InChIKey | CDYZZWWYHDTHFU-JGPKDBRGSA-N |
| XLogP | 5.56 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |