C28H34F3N3O3 — CID 59777980
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-hydroxyethyl)piperidine-4-carboxamide (PubChem CID 59777980) has the molecular formula C28H34F3N3O3 and a molecular weight of 517.59 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-hydroxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-hydroxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 59777980 |
| Molecular Formula | C28H34F3N3O3 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-hydroxyethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCO)C1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C28H34F3N3O3/c29-28(30,31)20-6-9-24-23(16-20)26-22(25(33-24)18-4-2-1-3-5-18)8-7-21(37-26)17-34-13-10-19(11-14-34)27(36)32-12-15-35/h1-6,9,16,19,21-22,25-26,33,35H,7-8,10-15,17H2,(H,32,36)/t21-,22+,25+,26+/m1/s1 |
| InChIKey | NBJLFCCZJYPYBR-HRHCJDDBSA-N |
| XLogP | 4.53 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |