C28H39N3O — CID 58956513
(2S,4aS,5S,10bS)-9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956513) has the molecular formula C28H39N3O and a molecular weight of 433.64 g/mol. Its IUPAC name is (2S,4aS,5S,10bS)-9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2S,4aS,5S,10bS)-9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956513 |
| Molecular Formula | C28H39N3O |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | (2S,4aS,5S,10bS)-9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CN1CCN(C[C@@H]2CC[C@H]3[C@@H](c4ccccc4)Nc4ccc(C(C)(C)C)cc4[C@H]3O2)CC1 |
| InChI | InChI=1S/C28H39N3O/c1-28(2,3)21-10-13-25-24(18-21)27-23(26(29-25)20-8-6-5-7-9-20)12-11-22(32-27)19-31-16-14-30(4)15-17-31/h5-10,13,18,22-23,26-27,29H,11-12,14-17,19H2,1-4H3/t22-,23-,26+,27-/m0/s1 |
| InChIKey | OMRVNSPKJUROIN-IDJLGEMNSA-N |
| XLogP | 5.23 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |