C23H29NO2 — CID 58956672
[(2R,4aR,5S,10bR)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol (PubChem CID 58956672) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is [(2R,4aR,5S,10bR)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol.
| Compound Name | [(2R,4aR,5S,10bR)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
|---|---|
| PubChem CID | 58956672 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [(2R,4aR,5S,10bR)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@@H]1O[C@@H](CO)CC[C@@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C23H29NO2/c1-23(2,3)16-9-12-20-19(13-16)22-18(11-10-17(14-25)26-22)21(24-20)15-7-5-4-6-8-15/h4-9,12-13,17-18,21-22,24-25H,10-11,14H2,1-3H3/t17-,18-,21-,22-/m1/s1 |
| InChIKey | GJASPOMRSZNOTB-MCEIDBOGSA-N |
| XLogP | 4.98 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |