C20H19F4NO3 — CID 58956454
4-[(4aS,5R,10bS)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol (PubChem CID 58956454) has the molecular formula C20H19F4NO3 and a molecular weight of 397.37 g/mol. Its IUPAC name is 4-[(4aS,5R,10bS)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol.
| Compound Name | 4-[(4aS,5R,10bS)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 58956454 |
| Molecular Formula | C20H19F4NO3 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4-[(4aS,5R,10bS)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol |
| SMILES | OCC1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C20H19F4NO3/c21-15-7-10(1-6-17(15)27)18-13-4-3-12(9-26)28-19(13)14-8-11(20(22,23)24)2-5-16(14)25-18/h1-2,5-8,12-13,18-19,25-27H,3-4,9H2/t12?,13-,18-,19-/m0/s1 |
| InChIKey | SAQTZYNGXFMTML-DEGYBPMOSA-N |
| XLogP | 4.55 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |