C17H20F3NO2 — CID 91463579
[(4aS,5S,10bS)-5-prop-1-enyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol (PubChem CID 91463579) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is [(4aS,5S,10bS)-5-prop-1-enyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol.
| Compound Name | [(4aS,5S,10bS)-5-prop-1-enyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
|---|---|
| PubChem CID | 91463579 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [(4aS,5S,10bS)-5-prop-1-enyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
| SMILES | CC=C[C@@H]1Nc2ccc(C(F)(F)F)cc2[C@H]2OC(CO)CC[C@@H]12 |
| InChI | InChI=1S/C17H20F3NO2/c1-2-3-14-12-6-5-11(9-22)23-16(12)13-8-10(17(18,19)20)4-7-15(13)21-14/h2-4,7-8,11-12,14,16,21-22H,5-6,9H2,1H3/t11?,12-,14-,16-/m0/s1 |
| InChIKey | DVXAUVZYXWELTJ-NXSDKMMFSA-N |
| XLogP | 3.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|