C20H20F3NO3 — CID 143454430
4-[(2S)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol (PubChem CID 143454430) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-[(2S)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol.
| Compound Name | 4-[(2S)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
|---|---|
| PubChem CID | 143454430 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[(2S)-2-(hydroxymethyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
| SMILES | OC[C@@H]1CCC2C(c3ccc(O)cc3)Nc3ccc(C(F)(F)F)cc3C2O1 |
| InChI | InChI=1S/C20H20F3NO3/c21-20(22,23)12-3-8-17-16(9-12)19-15(7-6-14(10-25)27-19)18(24-17)11-1-4-13(26)5-2-11/h1-5,8-9,14-15,18-19,24-26H,6-7,10H2/t14-,15?,18?,19?/m0/s1 |
| InChIKey | ZSRWZRFNLTWXEM-PLDSJADBSA-N |
| XLogP | 4.41 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |