C27H32F3N3O4 — CID 58956614
[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-(2-hydroxyethyl)piperazine-1-carboxylate (PubChem CID 58956614) has the molecular formula C27H32F3N3O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-(2-hydroxyethyl)piperazine-1-carboxylate.
| Compound Name | [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-(2-hydroxyethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58956614 |
| Molecular Formula | C27H32F3N3O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl 4-(2-hydroxyethyl)piperazine-1-carboxylate |
| SMILES | O=C(OC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C27H32F3N3O4/c28-27(29,30)19-6-9-23-22(16-19)25-21(24(31-23)18-4-2-1-3-5-18)8-7-20(37-25)17-36-26(35)33-12-10-32(11-13-33)14-15-34/h1-6,9,16,20-21,24-25,31,34H,7-8,10-15,17H2/t20-,21+,24+,25+/m1/s1 |
| InChIKey | BBKJUQVJTLSJJQ-QKYMMTCKSA-N |
| XLogP | 4.45 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |