C28H37F3N4O3 — CID 59777715
[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-[3-[2-(dimethylamino)ethylamino]propyl]carbamate (PubChem CID 59777715) has the molecular formula C28H37F3N4O3 and a molecular weight of 534.62 g/mol. Its IUPAC name is [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-[3-[2-(dimethylamino)ethylamino]propyl]carbamate.
| Compound Name | [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-[3-[2-(dimethylamino)ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 59777715 |
| Molecular Formula | C28H37F3N4O3 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl N-[3-[2-(dimethylamino)ethylamino]propyl]carbamate |
| SMILES | CN(C)CCNCCCNC(=O)OC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C28H37F3N4O3/c1-35(2)16-15-32-13-6-14-33-27(36)37-18-21-10-11-22-25(19-7-4-3-5-8-19)34-24-12-9-20(28(29,30)31)17-23(24)26(22)38-21/h3-5,7-9,12,17,21-22,25-26,32,34H,6,10-11,13-16,18H2,1-2H3,(H,33,36)/t21-,22+,25+,26+/m1/s1 |
| InChIKey | NXAOLZPAKADHGX-HRHCJDDBSA-N |
| XLogP | 4.98 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|