C25H30F4N4O2 — CID 59777755
1-[[(2R,4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea (PubChem CID 59777755) has the molecular formula C25H30F4N4O2 and a molecular weight of 494.53 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 59777755 |
| Molecular Formula | C25H30F4N4O2 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethyl]urea |
| SMILES | CN(C)CCNC(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C25H30F4N4O2/c1-33(2)11-10-30-24(34)31-14-18-7-8-19-22(15-4-3-5-17(26)12-15)32-21-9-6-16(25(27,28)29)13-20(21)23(19)35-18/h3-6,9,12-13,18-19,22-23,32H,7-8,10-11,14H2,1-2H3,(H2,30,31,34)/t18-,19+,22+,23+/m1/s1 |
| InChIKey | QAZORHYWXSNPMD-FUKQBSRTSA-N |
| XLogP | 4.71 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |