C26H35F3N4O2 — CID 70801538
1-[2-[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]ethyl]-3-[2-(dimethylamino)ethyl]urea (PubChem CID 70801538) has the molecular formula C26H35F3N4O2 and a molecular weight of 492.59 g/mol. Its IUPAC name is 1-[2-[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]ethyl]-3-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-[2-[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]ethyl]-3-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 70801538 |
| Molecular Formula | C26H35F3N4O2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 1-[2-[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]ethyl]-3-[2-(dimethylamino)ethyl]urea |
| SMILES | CN(C)CCNC(=O)NCC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C26H35F3N4O2/c1-33(2)15-14-31-25(34)30-13-12-19-9-10-20-23(17-6-4-3-5-7-17)32-22-11-8-18(26(27,28)29)16-21(22)24(20)35-19/h3-6,8,11,16-17,19-20,23-24,32H,7,9-10,12-15H2,1-2H3,(H2,30,31,34)/t17?,19-,20+,23+,24+/m1/s1 |
| InChIKey | HYPHYFNKLVGUPK-UDVMZXGQSA-N |
| XLogP | 4.72 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |