C21H25F3N2O3S — CID 70801122
N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]methanesulfonamide (PubChem CID 70801122) has the molecular formula C21H25F3N2O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 70801122 |
| Molecular Formula | C21H25F3N2O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C21H25F3N2O3S/c1-30(27,28)25-12-15-8-9-16-19(13-5-3-2-4-6-13)26-18-10-7-14(21(22,23)24)11-17(18)20(16)29-15/h2-5,7,10-11,13,15-16,19-20,25-26H,6,8-9,12H2,1H3/t13?,15-,16+,19+,20+/m1/s1 |
| InChIKey | MAJIDHWFKACUKP-PBTUWZRVSA-N |
| XLogP | 4.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |