C25H34F3N3O4S — CID 70801160
N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-hydroxyethylamino)propane-1-sulfonamide (PubChem CID 70801160) has the molecular formula C25H34F3N3O4S and a molecular weight of 529.63 g/mol. Its IUPAC name is N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-hydroxyethylamino)propane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-hydroxyethylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 70801160 |
| Molecular Formula | C25H34F3N3O4S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(2-hydroxyethylamino)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCNCCO)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C25H34F3N3O4S/c26-25(27,28)18-7-10-22-21(15-18)24-20(23(31-22)17-5-2-1-3-6-17)9-8-19(35-24)16-30-36(33,34)14-4-11-29-12-13-32/h1-3,5,7,10,15,17,19-20,23-24,29-32H,4,6,8-9,11-14,16H2/t17?,19-,20+,23+,24+/m1/s1 |
| InChIKey | WXGMDWVHYLZZOY-UDVMZXGQSA-N |
| XLogP | 3.36 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|