C25H30F3NO3 — CID 70804006
[(4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate (PubChem CID 70804006) has the molecular formula C25H30F3NO3 and a molecular weight of 449.51 g/mol. Its IUPAC name is [(4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate.
| Compound Name | [(4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 70804006 |
| Molecular Formula | C25H30F3NO3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCC1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C25H30F3NO3/c1-2-3-9-22(30)31-15-18-11-12-19-23(16-7-5-4-6-8-16)29-21-13-10-17(25(26,27)28)14-20(21)24(19)32-18/h4-7,10,13-14,16,18-19,23-24,29H,2-3,8-9,11-12,15H2,1H3/t16?,18?,19-,23-,24-/m0/s1 |
| InChIKey | JKOSBELPFXUFHV-NEYGVLTLSA-N |
| XLogP | 6.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |