C25H29F4NO3 — CID 70804008
[(2R,4aS,5R,10bS)-5-(6-fluorocyclohexa-2,4-dien-1-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate (PubChem CID 70804008) has the molecular formula C25H29F4NO3 and a molecular weight of 467.50 g/mol. Its IUPAC name is [(2R,4aS,5R,10bS)-5-(6-fluorocyclohexa-2,4-dien-1-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate.
| Compound Name | [(2R,4aS,5R,10bS)-5-(6-fluorocyclohexa-2,4-dien-1-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 70804008 |
| Molecular Formula | C25H29F4NO3 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | [(2R,4aS,5R,10bS)-5-(6-fluorocyclohexa-2,4-dien-1-yl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1F |
| InChI | InChI=1S/C25H29F4NO3/c1-2-3-8-22(31)32-14-16-10-11-18-23(17-6-4-5-7-20(17)26)30-21-12-9-15(25(27,28)29)13-19(21)24(18)33-16/h4-7,9,12-13,16-18,20,23-24,30H,2-3,8,10-11,14H2,1H3/t16-,17?,18+,20?,23+,24+/m1/s1 |
| InChIKey | VKGWYBLBQUGRDJ-GKBCKJOGSA-N |
| XLogP | 6.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |