C26H33F3N4O2 — CID 70800795
N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-piperazin-1-ylacetamide (PubChem CID 70800795) has the molecular formula C26H33F3N4O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-piperazin-1-ylacetamide.
| Compound Name | N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 70800795 |
| Molecular Formula | C26H33F3N4O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-piperazin-1-ylacetamide |
| SMILES | O=C(CN1CCNCC1)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C26H33F3N4O2/c27-26(28,29)18-6-9-22-21(14-18)25-20(24(32-22)17-4-2-1-3-5-17)8-7-19(35-25)15-31-23(34)16-33-12-10-30-11-13-33/h1-4,6,9,14,17,19-20,24-25,30,32H,5,7-8,10-13,15-16H2,(H,31,34)/t17?,19-,20+,24+,25+/m1/s1 |
| InChIKey | UHQYHQNUTUBQJU-IDATXIPASA-N |
| XLogP | 3.49 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |