C30H35F3N4O2 — CID 70801109
N-[2-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]-3-pyridin-3-ylpropanamide (PubChem CID 70801109) has the molecular formula C30H35F3N4O2 and a molecular weight of 540.63 g/mol. Its IUPAC name is N-[2-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[2-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 70801109 |
| Molecular Formula | C30H35F3N4O2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | N-[2-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]ethyl]-3-pyridin-3-ylpropanamide |
| SMILES | O=C(CCc1cccnc1)NCCNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C30H35F3N4O2/c31-30(32,33)22-9-12-26-25(17-22)29-24(28(37-26)21-6-2-1-3-7-21)11-10-23(39-29)19-35-15-16-36-27(38)13-8-20-5-4-14-34-18-20/h1-6,9,12,14,17-18,21,23-24,28-29,35,37H,7-8,10-11,13,15-16,19H2,(H,36,38)/t21?,23-,24+,28+,29+/m1/s1 |
| InChIKey | ULFKAKMZPQHSSK-NUAHCIIQSA-N |
| XLogP | 5.20 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|