C29H40F3N3O3 — CID 70804137
tert-butyl N-[4-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]butyl]carbamate (PubChem CID 70804137) has the molecular formula C29H40F3N3O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 70804137 |
| Molecular Formula | C29H40F3N3O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | tert-butyl N-[4-[[(2R,4aS,5S,10bS)-5-cyclohexa-2,4-dien-1-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2C1C=CC=CC1 |
| InChI | InChI=1S/C29H40F3N3O3/c1-28(2,3)38-27(36)34-16-8-7-15-33-18-21-12-13-22-25(19-9-5-4-6-10-19)35-24-14-11-20(29(30,31)32)17-23(24)26(22)37-21/h4-6,9,11,14,17,19,21-22,25-26,33,35H,7-8,10,12-13,15-16,18H2,1-3H3,(H,34,36)/t19?,21-,22+,25+,26+/m1/s1 |
| InChIKey | TXCKPWYVRQOVFX-LEZPQXETSA-N |
| XLogP | 6.36 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|