C27H32F3N3O3 — CID 159336275
4-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-[2-(dimethylamino)ethyl]-2-oxobutanamide (PubChem CID 159336275) has the molecular formula C27H32F3N3O3 and a molecular weight of 503.57 g/mol. Its IUPAC name is 4-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-[2-(dimethylamino)ethyl]-2-oxobutanamide.
| Compound Name | 4-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-[2-(dimethylamino)ethyl]-2-oxobutanamide |
|---|---|
| PubChem CID | 159336275 |
| Molecular Formula | C27H32F3N3O3 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 4-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-[2-(dimethylamino)ethyl]-2-oxobutanamide |
| SMILES | CN(C)CCNC(=O)C(=O)CC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H32F3N3O3/c1-33(2)15-14-31-26(35)23(34)13-10-19-9-11-20-24(17-6-4-3-5-7-17)32-22-12-8-18(27(28,29)30)16-21(22)25(20)36-19/h3-8,12,16,19-20,24-25,32H,9-11,13-15H2,1-2H3,(H,31,35)/t19-,20+,24+,25+/m1/s1 |
| InChIKey | OHLCLHDPIZEWBT-PXTBKIQTSA-N |
| XLogP | 4.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|