C24H29F3N4O2 — CID 11989793
1-[2-(dimethylamino)ethyl]-3-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]urea (PubChem CID 11989793) has the molecular formula C24H29F3N4O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]urea |
|---|---|
| PubChem CID | 11989793 |
| Molecular Formula | C24H29F3N4O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]urea |
| SMILES | CN(C)CCNC(=O)NC1COC2c3cc(C(F)(F)F)ccc3NC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C24H29F3N4O2/c1-31(2)11-10-28-23(32)29-17-13-19-21(15-6-4-3-5-7-15)30-20-9-8-16(24(25,26)27)12-18(20)22(19)33-14-17/h3-9,12,17,19,21-22,30H,10-11,13-14H2,1-2H3,(H2,28,29,32) |
| InChIKey | QBEDZOUXYLCUNR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |