C28H39F3N4O — CID 71193226
1-[2-(dimethylamino)ethyl]-3-[(3R)-3-methyl-5-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]pentyl]urea (PubChem CID 71193226) has the molecular formula C28H39F3N4O and a molecular weight of 504.64 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[(3R)-3-methyl-5-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]pentyl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[(3R)-3-methyl-5-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]pentyl]urea |
|---|---|
| PubChem CID | 71193226 |
| Molecular Formula | C28H39F3N4O |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[(3R)-3-methyl-5-[(2R,3R,4S)-4-methyl-2-phenyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]pentyl]urea |
| SMILES | C[C@@H](CCNC(=O)NCCN(C)C)CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H39F3N4O/c1-19(14-15-32-27(36)33-16-17-35(3)4)10-12-23-20(2)24-18-22(28(29,30)31)11-13-25(24)34-26(23)21-8-6-5-7-9-21/h5-9,11,13,18-20,23,26,34H,10,12,14-17H2,1-4H3,(H2,32,33,36)/t19-,20+,23-,26+/m1/s1 |
| InChIKey | OOAKYVQYGMNJPW-XKCHLWDXSA-N |
| XLogP | 6.26 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |