C26H36F3N3O — CID 71193654
N-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]-3-(methylamino)propanamide (PubChem CID 71193654) has the molecular formula C26H36F3N3O and a molecular weight of 463.59 g/mol. Its IUPAC name is N-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]-3-(methylamino)propanamide.
| Compound Name | N-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 71193654 |
| Molecular Formula | C26H36F3N3O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[(2R)-4-[(2S,3R,4S)-2-cyclohexa-2,4-dien-1-yl-4-methyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-3-yl]-2-methylbutyl]-3-(methylamino)propanamide |
| SMILES | CNCCC(=O)NC[C@H](C)CC[C@@H]1[C@H](C)c2cc(C(F)(F)F)ccc2N[C@H]1C1C=CC=CC1 |
| InChI | InChI=1S/C26H36F3N3O/c1-17(16-31-24(33)13-14-30-3)9-11-21-18(2)22-15-20(26(27,28)29)10-12-23(22)32-25(21)19-7-5-4-6-8-19/h4-7,10,12,15,17-19,21,25,30,32H,8-9,11,13-14,16H2,1-3H3,(H,31,33)/t17-,18+,19?,21-,25+/m1/s1 |
| InChIKey | SZKDBBJBQPISMU-QZYNHPEISA-N |
| XLogP | 5.49 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |